C17H14Cl2N2O5 — CID 110615456
N-(1,3-benzodioxol-5-yl)-2-[[2-(2,5-dichlorophenoxy)acetyl]amino]acetamide (PubChem CID 110615456) has the molecular formula C17H14Cl2N2O5 and a molecular weight of 397.21 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[2-(2,5-dichlorophenoxy)acetyl]amino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(2,5-dichlorophenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 110615456 |
| Molecular Formula | C17H14Cl2N2O5 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(2,5-dichlorophenoxy)acetyl]amino]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14Cl2N2O5/c18-10-1-3-12(19)14(5-10)24-8-17(23)20-7-16(22)21-11-2-4-13-15(6-11)26-9-25-13/h1-6H,7-9H2,(H,20,23)(H,21,22) |
| InChIKey | CMUPPTNJXAAYGS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |