C19H17Cl2NO4 — CID 110344658
4-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-oxobutanamide (PubChem CID 110344658) has the molecular formula C19H17Cl2NO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-oxobutanamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110344658 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OCO2)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2NO4/c20-14-3-1-12(15(21)10-14)7-8-22-19(24)6-4-16(23)13-2-5-17-18(9-13)26-11-25-17/h1-3,5,9-10H,4,6-8,11H2,(H,22,24) |
| InChIKey | CUXLTGZNISKTGJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |