C14H14Cl2N2O2 — CID 110679038
N-[2-(2,4-dichlorophenyl)ethyl]-3-(1,3-oxazol-4-yl)propanamide (PubChem CID 110679038) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-(1,3-oxazol-4-yl)propanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-(1,3-oxazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110679038 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-(1,3-oxazol-4-yl)propanamide |
| SMILES | O=C(CCc1cocn1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-11-2-1-10(13(16)7-11)5-6-17-14(19)4-3-12-8-20-9-18-12/h1-2,7-9H,3-6H2,(H,17,19) |
| InChIKey | DCJJSXWAZMOZKV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |