C24H15BrClNO2 — CID 102071898
4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-6-(4-chlorophenyl)pyridine (PubChem CID 102071898) has the molecular formula C24H15BrClNO2 and a molecular weight of 464.75 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-6-(4-chlorophenyl)pyridine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-6-(4-chlorophenyl)pyridine |
|---|---|
| PubChem CID | 102071898 |
| Molecular Formula | C24H15BrClNO2 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(4-bromophenyl)-6-(4-chlorophenyl)pyridine |
| SMILES | Clc1ccc(-c2cc(-c3ccc4c(c3)OCO4)cc(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C24H15BrClNO2/c25-19-6-1-15(2-7-19)21-11-18(17-5-10-23-24(13-17)29-14-28-23)12-22(27-21)16-3-8-20(26)9-4-16/h1-13H,14H2 |
| InChIKey | KEORPSVGKCZWSC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |