C21H26F2N4O6S — CID 166755042
2-[2-[2-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]ethoxy]ethoxy]acetamide (PubChem CID 166755042) has the molecular formula C21H26F2N4O6S and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-[2-[2-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]ethoxy]ethoxy]acetamide.
| Compound Name | 2-[2-[2-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 166755042 |
| Molecular Formula | C21H26F2N4O6S |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[2-[2-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]ethoxy]ethoxy]acetamide |
| SMILES | NC(=O)COCCOCCNC(=O)COc1c(-c2csc(N3CCOCC3)n2)ccc(F)c1F |
| InChI | InChI=1S/C21H26F2N4O6S/c22-15-2-1-14(16-13-34-21(26-16)27-4-7-31-8-5-27)20(19(15)23)33-12-18(29)25-3-6-30-9-10-32-11-17(24)28/h1-2,13H,3-12H2,(H2,24,28)(H,25,29) |
| InChIKey | IUQHACNHKADJKN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|