C40H48F2N6O8S — CID 155022225
2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]-N-[10-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethylamino]decyl]acetamide (PubChem CID 155022225) has the molecular formula C40H48F2N6O8S and a molecular weight of 810.92 g/mol. Its IUPAC name is 2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]-N-[10-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethylamino]decyl]acetamide.
| Compound Name | 2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]-N-[10-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethylamino]decyl]acetamide |
|---|---|
| PubChem CID | 155022225 |
| Molecular Formula | C40H48F2N6O8S |
| Molecular Weight | 810.92 g/mol |
| Exact Mass | 810.32 |
| IUPAC Name | 2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]-N-[10-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethylamino]decyl]acetamide |
| SMILES | O=C(COc1c(-c2csc(N3CCOCC3)n2)ccc(F)c1F)NCCCCCCCCCCNCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C40H48F2N6O8S/c41-28-13-12-26(29-25-57-40(45-29)47-19-22-54-23-20-47)36(35(28)42)56-24-33(50)44-17-8-6-4-2-1-3-5-7-16-43-18-21-55-31-11-9-10-27-34(31)39(53)48(38(27)52)30-14-15-32(49)46-37(30)51/h9-13,25,30,43H,1-8,14-24H2,(H,44,50)(H,46,49,51) |
| InChIKey | XOSAOFHGRSQDEW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 168.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.92 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|