C28H40F2N4O5S — CID 171565050
tert-butyl N-[8-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]octyl]carbamate (PubChem CID 171565050) has the molecular formula C28H40F2N4O5S and a molecular weight of 582.71 g/mol. Its IUPAC name is tert-butyl N-[8-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]octyl]carbamate.
| Compound Name | tert-butyl N-[8-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]octyl]carbamate |
|---|---|
| PubChem CID | 171565050 |
| Molecular Formula | C28H40F2N4O5S |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | tert-butyl N-[8-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]octyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCNC(=O)COc1c(-c2csc(N3CCOCC3)n2)ccc(F)c1F |
| InChI | InChI=1S/C28H40F2N4O5S/c1-28(2,3)39-27(36)32-13-9-7-5-4-6-8-12-31-23(35)18-38-25-20(10-11-21(29)24(25)30)22-19-40-26(33-22)34-14-16-37-17-15-34/h10-11,19H,4-9,12-18H2,1-3H3,(H,31,35)(H,32,36) |
| InChIKey | KAMYXJHNZDJIOI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|