C26H36F2N4O5S — CID 175187545
6-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]hexyl N-tert-butylcarbamate (PubChem CID 175187545) has the molecular formula C26H36F2N4O5S and a molecular weight of 554.66 g/mol. Its IUPAC name is 6-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]hexyl N-tert-butylcarbamate.
| Compound Name | 6-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]hexyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175187545 |
| Molecular Formula | C26H36F2N4O5S |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 6-[[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]acetyl]amino]hexyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCCCCNC(=O)COc1c(-c2csc(N3CCOCC3)n2)ccc(F)c1F |
| InChI | InChI=1S/C26H36F2N4O5S/c1-26(2,3)31-25(34)36-13-7-5-4-6-10-29-21(33)16-37-23-18(8-9-19(27)22(23)28)20-17-38-24(30-20)32-11-14-35-15-12-32/h8-9,17H,4-7,10-16H2,1-3H3,(H,29,33)(H,31,34) |
| InChIKey | PBXMHBKDHFJVMM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|