C32H33F2N5O8S — CID 154612142
4-[2-[2-[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]ethoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 154612142) has the molecular formula C32H33F2N5O8S and a molecular weight of 685.71 g/mol. Its IUPAC name is 4-[2-[2-[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]ethoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[2-[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]ethoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 154612142 |
| Molecular Formula | C32H33F2N5O8S |
| Molecular Weight | 685.71 g/mol |
| Exact Mass | 685.20 |
| IUPAC Name | 4-[2-[2-[2-[2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenoxy]ethoxy]ethoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOc4c(-c5csc(N6CCOCC6)n5)ccc(F)c4F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H33F2N5O8S/c33-21-5-4-19(23-18-48-32(36-23)38-9-12-45-13-10-38)28(27(21)34)47-17-16-46-15-14-44-11-8-35-22-3-1-2-20-26(22)31(43)39(30(20)42)24-6-7-25(40)37-29(24)41/h1-5,18,24,35H,6-17H2,(H,37,40,41) |
| InChIKey | SBFOORBQHVOGJM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|