C16H21N3O2S — CID 172900508
4-[1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]morpholine (PubChem CID 172900508) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-[1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]morpholine.
| Compound Name | 4-[1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]morpholine |
|---|---|
| PubChem CID | 172900508 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-[1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-3-yl]morpholine |
| SMILES | COc1ccc2sc(N3CCC(N4CCOCC4)C3)nc2c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-20-13-2-3-15-14(10-13)17-16(22-15)19-5-4-12(11-19)18-6-8-21-9-7-18/h2-3,10,12H,4-9,11H2,1H3 |
| InChIKey | PWIWAWOQTJFYRU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |