C11H8N2OS2 — CID 101007756
4-(1,3-benzothiazol-2-ylsulfanyl)-1,4-oxazine (PubChem CID 101007756) has the molecular formula C11H8N2OS2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-1,4-oxazine.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1,4-oxazine |
|---|---|
| PubChem CID | 101007756 |
| Molecular Formula | C11H8N2OS2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1,4-oxazine |
| SMILES | C1=CN(Sc2nc3ccccc3s2)C=CO1 |
| InChI | InChI=1S/C11H8N2OS2/c1-2-4-10-9(3-1)12-11(15-10)16-13-5-7-14-8-6-13/h1-8H |
| InChIKey | XZSPLHXJNWUVGK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|