C21H18BrN5S — CID 2218152
3-[[4-(4-bromophenyl)-5-(2,3-dimethyl-1H-indol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 2218152) has the molecular formula C21H18BrN5S and a molecular weight of 452.38 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-5-(2,3-dimethyl-1H-indol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[4-(4-bromophenyl)-5-(2,3-dimethyl-1H-indol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 2218152 |
| Molecular Formula | C21H18BrN5S |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-5-(2,3-dimethyl-1H-indol-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | Cc1[nH]c2ccc(-c3nnc(SCCC#N)n3-c3ccc(Br)cc3)cc2c1C |
| InChI | InChI=1S/C21H18BrN5S/c1-13-14(2)24-19-9-4-15(12-18(13)19)20-25-26-21(28-11-3-10-23)27(20)17-7-5-16(22)6-8-17/h4-9,12,24H,3,11H2,1-2H3 |
| InChIKey | RQVPTBHGBAPIGM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|