C24H28N4S — CID 5223985
5-(5-hexylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole (PubChem CID 5223985) has the molecular formula C24H28N4S and a molecular weight of 404.58 g/mol. Its IUPAC name is 5-(5-hexylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole.
| Compound Name | 5-(5-hexylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 5223985 |
| Molecular Formula | C24H28N4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 5-(5-hexylsulfanyl-4-phenyl-1,2,4-triazol-3-yl)-2,3-dimethyl-1H-indole |
| SMILES | CCCCCCSc1nnc(-c2ccc3[nH]c(C)c(C)c3c2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H28N4S/c1-4-5-6-10-15-29-24-27-26-23(28(24)20-11-8-7-9-12-20)19-13-14-22-21(16-19)17(2)18(3)25-22/h7-9,11-14,16,25H,4-6,10,15H2,1-3H3 |
| InChIKey | FBXQSUPXAIZMAM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|