C22H26N4OS — CID 40670280
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-hexylacetamide (PubChem CID 40670280) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-hexylacetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-hexylacetamide |
|---|---|
| PubChem CID | 40670280 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H26N4OS/c1-2-3-4-11-16-23-20(27)17-28-22-25-24-21(18-12-7-5-8-13-18)26(22)19-14-9-6-10-15-19/h5-10,12-15H,2-4,11,16-17H2,1H3,(H,23,27) |
| InChIKey | LWGNSVHBGQSDMA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|