C21H24N4OS — CID 17483969
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-pentylacetamide (PubChem CID 17483969) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-pentylacetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 17483969 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H24N4OS/c1-2-3-10-15-22-19(26)16-27-21-24-23-20(17-11-6-4-7-12-17)25(21)18-13-8-5-9-14-18/h4-9,11-14H,2-3,10,15-16H2,1H3,(H,22,26) |
| InChIKey | ICEAOJXRTLBVCY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|