C24H24N4O4S — CID 46134599
4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(2-methoxyethyl)benzamide (PubChem CID 46134599) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 46134599 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(CSc2nnc(-c3ccco3)n2-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-30-15-13-25-23(29)18-11-9-17(10-12-18)16-33-24-27-26-22(21-8-5-14-32-21)28(24)19-6-3-4-7-20(19)31-2/h3-12,14H,13,15-16H2,1-2H3,(H,25,29) |
| InChIKey | NCQRUJHYSNFTCL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|