C32H35N3O2S — CID 42658695
5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1,2-diphenylethyl)pentanamide (PubChem CID 42658695) has the molecular formula C32H35N3O2S and a molecular weight of 525.72 g/mol. Its IUPAC name is 5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1,2-diphenylethyl)pentanamide.
| Compound Name | 5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1,2-diphenylethyl)pentanamide |
|---|---|
| PubChem CID | 42658695 |
| Molecular Formula | C32H35N3O2S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-(1,2-diphenylethyl)pentanamide |
| SMILES | Cc1nc(SCCCCC(=O)NC(Cc2ccccc2)c2ccccc2)n(C)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C32H35N3O2S/c1-24-28(22-25-14-6-3-7-15-25)31(37)35(2)32(33-24)38-21-13-12-20-30(36)34-29(27-18-10-5-11-19-27)23-26-16-8-4-9-17-26/h3-11,14-19,29H,12-13,20-23H2,1-2H3,(H,34,36) |
| InChIKey | PVSFQLRKLWRWDX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|