C24H33N3O2S — CID 42738597
5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-cyclohexylpentanamide (PubChem CID 42738597) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is 5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-cyclohexylpentanamide.
| Compound Name | 5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-cyclohexylpentanamide |
|---|---|
| PubChem CID | 42738597 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-cyclohexylpentanamide |
| SMILES | Cc1nc(SCCCCC(=O)NC2CCCCC2)n(C)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C24H33N3O2S/c1-18-21(17-19-11-5-3-6-12-19)23(29)27(2)24(25-18)30-16-10-9-15-22(28)26-20-13-7-4-8-14-20/h3,5-6,11-12,20H,4,7-10,13-17H2,1-2H3,(H,26,28) |
| InChIKey | ZDJLCQZBBPVGAV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|