C24H31N3O4S — CID 42738630
5-benzyl-2-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxobutyl]sulfanyl-3,6-dimethylpyrimidin-4-one (PubChem CID 42738630) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 5-benzyl-2-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxobutyl]sulfanyl-3,6-dimethylpyrimidin-4-one.
| Compound Name | 5-benzyl-2-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxobutyl]sulfanyl-3,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 42738630 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 5-benzyl-2-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-oxobutyl]sulfanyl-3,6-dimethylpyrimidin-4-one |
| SMILES | Cc1nc(SCCCC(=O)N2CCC3(CC2)OCCO3)n(C)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-18-20(17-19-7-4-3-5-8-19)22(29)26(2)23(25-18)32-16-6-9-21(28)27-12-10-24(11-13-27)30-14-15-31-24/h3-5,7-8H,6,9-17H2,1-2H3 |
| InChIKey | RXMHHHKVSVPHKF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|