C38H46N4O2S — CID 42658899
2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]sulfanyl-5-[(4-tert-butylphenyl)methyl]-3,6-dimethylpyrimidin-4-one (PubChem CID 42658899) has the molecular formula C38H46N4O2S and a molecular weight of 622.88 g/mol. Its IUPAC name is 2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]sulfanyl-5-[(4-tert-butylphenyl)methyl]-3,6-dimethylpyrimidin-4-one.
| Compound Name | 2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]sulfanyl-5-[(4-tert-butylphenyl)methyl]-3,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 42658899 |
| Molecular Formula | C38H46N4O2S |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]sulfanyl-5-[(4-tert-butylphenyl)methyl]-3,6-dimethylpyrimidin-4-one |
| SMILES | Cc1nc(SCCCC(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)n(C)c(=O)c1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C38H46N4O2S/c1-28-33(27-29-18-20-32(21-19-29)38(2,3)4)36(44)40(5)37(39-28)45-26-12-17-34(43)41-22-24-42(25-23-41)35(30-13-8-6-9-14-30)31-15-10-7-11-16-31/h6-11,13-16,18-21,35H,12,17,22-27H2,1-5H3 |
| InChIKey | GFANOAUTAFFIJB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|