C31H35N5OS — CID 42730682
1-(4-benzhydrylpiperazin-1-yl)-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one (PubChem CID 42730682) has the molecular formula C31H35N5OS and a molecular weight of 525.72 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
|---|---|
| PubChem CID | 42730682 |
| Molecular Formula | C31H35N5OS |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-5-[(5-methyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
| SMILES | Cc1nnc(SCCCCC(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)n1-c1ccccc1 |
| InChI | InChI=1S/C31H35N5OS/c1-25-32-33-31(36(25)28-17-9-4-10-18-28)38-24-12-11-19-29(37)34-20-22-35(23-21-34)30(26-13-5-2-6-14-26)27-15-7-3-8-16-27/h2-10,13-18,30H,11-12,19-24H2,1H3 |
| InChIKey | HVLKPDNWEIBLCO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|