C29H36N4O3S — CID 42739627
2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]sulfanyl-3,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-one (PubChem CID 42739627) has the molecular formula C29H36N4O3S and a molecular weight of 520.70 g/mol. Its IUPAC name is 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]sulfanyl-3,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]sulfanyl-3,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 42739627 |
| Molecular Formula | C29H36N4O3S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutyl]sulfanyl-3,6-dimethyl-5-[(3-methylphenyl)methyl]pyrimidin-4-one |
| SMILES | COc1ccc(N2CCN(C(=O)CCCSc3nc(C)c(Cc4cccc(C)c4)c(=O)n3C)CC2)cc1 |
| InChI | InChI=1S/C29H36N4O3S/c1-21-7-5-8-23(19-21)20-26-22(2)30-29(31(3)28(26)35)37-18-6-9-27(34)33-16-14-32(15-17-33)24-10-12-25(36-4)13-11-24/h5,7-8,10-13,19H,6,9,14-18,20H2,1-4H3 |
| InChIKey | DGJRLBFNUBRQKN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|