C28H33N5O5S — CID 5227109
5-benzyl-6-(methoxymethyl)-3-methyl-2-[4-[4-(4-nitrophenyl)piperazin-1-yl]-4-oxobutyl]sulfanylpyrimidin-4-one (PubChem CID 5227109) has the molecular formula C28H33N5O5S and a molecular weight of 551.67 g/mol. Its IUPAC name is 5-benzyl-6-(methoxymethyl)-3-methyl-2-[4-[4-(4-nitrophenyl)piperazin-1-yl]-4-oxobutyl]sulfanylpyrimidin-4-one.
| Compound Name | 5-benzyl-6-(methoxymethyl)-3-methyl-2-[4-[4-(4-nitrophenyl)piperazin-1-yl]-4-oxobutyl]sulfanylpyrimidin-4-one |
|---|---|
| PubChem CID | 5227109 |
| Molecular Formula | C28H33N5O5S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 5-benzyl-6-(methoxymethyl)-3-methyl-2-[4-[4-(4-nitrophenyl)piperazin-1-yl]-4-oxobutyl]sulfanylpyrimidin-4-one |
| SMILES | COCc1nc(SCCCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(C)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C28H33N5O5S/c1-30-27(35)24(19-21-7-4-3-5-8-21)25(20-38-2)29-28(30)39-18-6-9-26(34)32-16-14-31(15-17-32)22-10-12-23(13-11-22)33(36)37/h3-5,7-8,10-13H,6,9,14-20H2,1-2H3 |
| InChIKey | GPFKFLVDKBKNOU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|