C22H30FN3O2S — CID 42738043
N-butyl-2-[5-[(4-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide (PubChem CID 42738043) has the molecular formula C22H30FN3O2S and a molecular weight of 419.57 g/mol. Its IUPAC name is N-butyl-2-[5-[(4-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide.
| Compound Name | N-butyl-2-[5-[(4-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide |
|---|---|
| PubChem CID | 42738043 |
| Molecular Formula | C22H30FN3O2S |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-butyl-2-[5-[(4-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide |
| SMILES | CCCCNC(=O)C(CCC)Sc1nc(C)c(Cc2ccc(F)cc2)c(=O)n1C |
| InChI | InChI=1S/C22H30FN3O2S/c1-5-7-13-24-20(27)19(8-6-2)29-22-25-15(3)18(21(28)26(22)4)14-16-9-11-17(23)12-10-16/h9-12,19H,5-8,13-14H2,1-4H3,(H,24,27) |
| InChIKey | MUNHPOPYGRMASW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|