C21H29N3O2S — CID 42738677
2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-propylpentanamide (PubChem CID 42738677) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-propylpentanamide.
| Compound Name | 2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-propylpentanamide |
|---|---|
| PubChem CID | 42738677 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanyl-N-propylpentanamide |
| SMILES | CCCNC(=O)C(CCC)Sc1nc(C)c(Cc2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C21H29N3O2S/c1-5-10-18(19(25)22-13-6-2)27-21-23-15(3)17(20(26)24(21)4)14-16-11-8-7-9-12-16/h7-9,11-12,18H,5-6,10,13-14H2,1-4H3,(H,22,25) |
| InChIKey | QIDCCXBCIFSFEZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |