C26H39N3O2S — CID 42740064
N-butyl-2-[5-[(4-tert-butylphenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide (PubChem CID 42740064) has the molecular formula C26H39N3O2S and a molecular weight of 457.68 g/mol. Its IUPAC name is N-butyl-2-[5-[(4-tert-butylphenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide.
| Compound Name | N-butyl-2-[5-[(4-tert-butylphenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide |
|---|---|
| PubChem CID | 42740064 |
| Molecular Formula | C26H39N3O2S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | N-butyl-2-[5-[(4-tert-butylphenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylpentanamide |
| SMILES | CCCCNC(=O)C(CCC)Sc1nc(C)c(Cc2ccc(C(C)(C)C)cc2)c(=O)n1C |
| InChI | InChI=1S/C26H39N3O2S/c1-8-10-16-27-23(30)22(11-9-2)32-25-28-18(3)21(24(31)29(25)7)17-19-12-14-20(15-13-19)26(4,5)6/h12-15,22H,8-11,16-17H2,1-7H3,(H,27,30) |
| InChIKey | MOJWMNWWVKJWON-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|