C25H29N3O2S — CID 42738673
N-benzyl-2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide (PubChem CID 42738673) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-benzyl-2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide.
| Compound Name | N-benzyl-2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 42738673 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-benzyl-2-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide |
| SMILES | CCCC(Sc1nc(C)c(Cc2ccccc2)c(=O)n1C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2S/c1-4-11-22(23(29)26-17-20-14-9-6-10-15-20)31-25-27-18(2)21(24(30)28(25)3)16-19-12-7-5-8-13-19/h5-10,12-15,22H,4,11,16-17H2,1-3H3,(H,26,29) |
| InChIKey | MFQOMXBQCULIOQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |