C24H24FN3O4S2 — CID 42743890
2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 42743890) has the molecular formula C24H24FN3O4S2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42743890 |
| Molecular Formula | C24H24FN3O4S2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-[[2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | O=C(CSCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C24H24FN3O4S2/c25-17-5-7-18(8-6-17)28-22(30)19-3-1-2-4-20(19)26-23(28)34-16-33-15-21(29)27-11-9-24(10-12-27)31-13-14-32-24/h1-8H,9-16H2 |
| InChIKey | GSXCGAYITCKUKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|