C29H29FN4O3S2 — CID 42743914
2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 42743914) has the molecular formula C29H29FN4O3S2 and a molecular weight of 564.71 g/mol. Its IUPAC name is 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42743914 |
| Molecular Formula | C29H29FN4O3S2 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-[[2-[4-(2-ethoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanylmethylsulfanyl]-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | CCOc1ccccc1N1CCN(C(=O)CSCSc2nc3ccccc3c(=O)n2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H29FN4O3S2/c1-2-37-26-10-6-5-9-25(26)32-15-17-33(18-16-32)27(35)19-38-20-39-29-31-24-8-4-3-7-23(24)28(36)34(29)22-13-11-21(30)12-14-22/h3-14H,2,15-20H2,1H3 |
| InChIKey | WGWWFFJZZAXTIA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|