C27H27N5O2S — CID 24679661
3-(4-ethylphenyl)-2-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one (PubChem CID 24679661) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(4-ethylphenyl)-2-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 24679661 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 3-(4-ethylphenyl)-2-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinazolin-4-one |
| SMILES | CCc1ccc(-n2c(SCC(=O)N3CCN(c4ccccn4)CC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H27N5O2S/c1-2-20-10-12-21(13-11-20)32-26(34)22-7-3-4-8-23(22)29-27(32)35-19-25(33)31-17-15-30(16-18-31)24-9-5-6-14-28-24/h3-14H,2,15-19H2,1H3 |
| InChIKey | FSPCTXBMIPFRNB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |