C26H36N4O3 — CID 129459468
(2S)-4-benzyl-1-[[4-hydroxy-1-(4-methoxyphenyl)piperidin-4-yl]methyl]-N-methylpiperazine-2-carboxamide (PubChem CID 129459468) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is (2S)-4-benzyl-1-[[4-hydroxy-1-(4-methoxyphenyl)piperidin-4-yl]methyl]-N-methylpiperazine-2-carboxamide.
| Compound Name | (2S)-4-benzyl-1-[[4-hydroxy-1-(4-methoxyphenyl)piperidin-4-yl]methyl]-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 129459468 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (2S)-4-benzyl-1-[[4-hydroxy-1-(4-methoxyphenyl)piperidin-4-yl]methyl]-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN(Cc2ccccc2)CCN1CC1(O)CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C26H36N4O3/c1-27-25(31)24-19-28(18-21-6-4-3-5-7-21)16-17-30(24)20-26(32)12-14-29(15-13-26)22-8-10-23(33-2)11-9-22/h3-11,24,32H,12-20H2,1-2H3,(H,27,31)/t24-/m0/s1 |
| InChIKey | XNXNAXCROMVYIU-DEOSSOPVSA-N |
| XLogP | 1.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|