C20H30N4O — CID 95563368
2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide (PubChem CID 95563368) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide.
| Compound Name | 2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 95563368 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide |
| SMILES | CCc1[nH]c2ccc(CNC(=O)CN3CC[C@@H](N(C)C)C3)cc2c1C |
| InChI | InChI=1S/C20H30N4O/c1-5-18-14(2)17-10-15(6-7-19(17)22-18)11-21-20(25)13-24-9-8-16(12-24)23(3)4/h6-7,10,16,22H,5,8-9,11-13H2,1-4H3,(H,21,25)/t16-/m1/s1 |
| InChIKey | MQLCAZRDFACZTJ-MRXNPFEDSA-N |
| XLogP | 2.29 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|