C19H27N3O3S — CID 56871225
2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide (PubChem CID 56871225) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 56871225 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-[(2-ethyl-3-methyl-1H-indol-5-yl)methyl]acetamide |
| SMILES | CCc1[nH]c2ccc(CNC(=O)CN(C)C3CCS(=O)(=O)C3)cc2c1C |
| InChI | InChI=1S/C19H27N3O3S/c1-4-17-13(2)16-9-14(5-6-18(16)21-17)10-20-19(23)11-22(3)15-7-8-26(24,25)12-15/h5-6,9,15,21H,4,7-8,10-12H2,1-3H3,(H,20,23) |
| InChIKey | YKSNCRVWVXQMDK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|