C17H23N3OS — CID 119937973
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119937973) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119937973 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | Cc1[nH]c2ccc(CNC(=O)CC3CSCCN3)cc2c1C |
| InChI | InChI=1S/C17H23N3OS/c1-11-12(2)20-16-4-3-13(7-15(11)16)9-19-17(21)8-14-10-22-6-5-18-14/h3-4,7,14,18,20H,5-6,8-10H2,1-2H3,(H,19,21) |
| InChIKey | QPBZSYSLOCHIDG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|