C20H27N3O — CID 119754604
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide (PubChem CID 119754604) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 119754604 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]acetamide |
| SMILES | Cc1[nH]c2ccc(CNC(=O)CC3CC4CCC(C3)N4)cc2c1C |
| InChI | InChI=1S/C20H27N3O/c1-12-13(2)22-19-6-3-14(9-18(12)19)11-21-20(24)10-15-7-16-4-5-17(8-15)23-16/h3,6,9,15-17,22-23H,4-5,7-8,10-11H2,1-2H3,(H,21,24) |
| InChIKey | VDOHYJNPVYVGPJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|