C11H16N2OS2 — CID 66422898
2-thiomorpholin-3-yl-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 66422898) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-thiomorpholin-3-yl-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 66422898 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-thiomorpholin-3-yl-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | O=C(CC1CSCCN1)NCc1ccsc1 |
| InChI | InChI=1S/C11H16N2OS2/c14-11(5-10-8-16-4-2-12-10)13-6-9-1-3-15-7-9/h1,3,7,10,12H,2,4-6,8H2,(H,13,14) |
| InChIKey | NMIWGLSRPVUBRP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |