C10H15N3O2S — CID 106417266
N-(1,2-oxazol-5-ylmethyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 106417266) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 106417266 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCc1ccno1 |
| InChI | InChI=1S/C10H15N3O2S/c14-10(5-8-7-16-4-3-11-8)12-6-9-1-2-13-15-9/h1-2,8,11H,3-7H2,(H,12,14) |
| InChIKey | HQVWBONFORVQKC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |