C11H16N4OS — CID 114110925
N-(pyrimidin-4-ylmethyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 114110925) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(pyrimidin-4-ylmethyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(pyrimidin-4-ylmethyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 114110925 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-(pyrimidin-4-ylmethyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCc1ccncn1 |
| InChI | InChI=1S/C11H16N4OS/c16-11(5-10-7-17-4-3-13-10)14-6-9-1-2-12-8-15-9/h1-2,8,10,13H,3-7H2,(H,14,16) |
| InChIKey | KXWSGWCORJSUOI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |