C10H14N4O2S — CID 116787040
N-(6-oxo-1H-pyridazin-3-yl)-2-thiomorpholin-3-ylacetamide (PubChem CID 116787040) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridazin-3-yl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(6-oxo-1H-pyridazin-3-yl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 116787040 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-(6-oxo-1H-pyridazin-3-yl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H14N4O2S/c15-9-2-1-8(13-14-9)12-10(16)5-7-6-17-4-3-11-7/h1-2,7,11H,3-6H2,(H,14,15)(H,12,13,16) |
| InChIKey | UNTFZFPAFWWQKE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |