C16H24N2OS — CID 66421005
N-(2,6-diethylphenyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 66421005) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66421005 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C16H24N2OS/c1-3-12-6-5-7-13(4-2)16(12)18-15(19)10-14-11-20-9-8-17-14/h5-7,14,17H,3-4,8-11H2,1-2H3,(H,18,19) |
| InChIKey | ZNSRXGACRGDLMF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |