C11H18N4OS — CID 113269028
N-[2-(1H-imidazol-2-yl)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 113269028) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is N-[2-(1H-imidazol-2-yl)ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-(1H-imidazol-2-yl)ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 113269028 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-[2-(1H-imidazol-2-yl)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCc1ncc[nH]1 |
| InChI | InChI=1S/C11H18N4OS/c16-11(7-9-8-17-6-5-12-9)15-2-1-10-13-3-4-14-10/h3-4,9,12H,1-2,5-8H2,(H,13,14)(H,15,16) |
| InChIKey | JMBPLHLNIPXMGQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |