C9H14N4OS — CID 82916761
N-(1H-imidazol-2-ylmethyl)thiomorpholine-3-carboxamide (PubChem CID 82916761) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82916761 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)thiomorpholine-3-carboxamide |
| SMILES | O=C(NCc1ncc[nH]1)C1CSCCN1 |
| InChI | InChI=1S/C9H14N4OS/c14-9(7-6-15-4-3-10-7)13-5-8-11-1-2-12-8/h1-2,7,10H,3-6H2,(H,11,12)(H,13,14) |
| InChIKey | FHNADSXWMVKZOJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |