C16H25ClN2O3S — CID 119936443
N-[(4-ethoxy-3-methoxyphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936443) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936443 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CCOc1ccc(CNC(=O)CC2CSCCN2)cc1OC.Cl |
| InChI | InChI=1S/C16H24N2O3S.ClH/c1-3-21-14-5-4-12(8-15(14)20-2)10-18-16(19)9-13-11-22-7-6-17-13;/h4-5,8,13,17H,3,6-7,9-11H2,1-2H3,(H,18,19);1H |
| InChIKey | QLAJKNLXAJOIOX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |