C16H22ClN3O2 — CID 119754617
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 119754617) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119754617 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | Cc1[nH]c2ccc(CNC(=O)C3CNCCO3)cc2c1C.Cl |
| InChI | InChI=1S/C16H21N3O2.ClH/c1-10-11(2)19-14-4-3-12(7-13(10)14)8-18-16(20)15-9-17-5-6-21-15;/h3-4,7,15,17,19H,5-6,8-9H2,1-2H3,(H,18,20);1H |
| InChIKey | WGGIXGAVLIRIIE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|