C19H24N2O4 — CID 154783519
3-[4-[(2,3-dimethyl-1H-indol-5-yl)methylcarbamoyl]oxolan-2-yl]propanoic acid (PubChem CID 154783519) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[4-[(2,3-dimethyl-1H-indol-5-yl)methylcarbamoyl]oxolan-2-yl]propanoic acid.
| Compound Name | 3-[4-[(2,3-dimethyl-1H-indol-5-yl)methylcarbamoyl]oxolan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 154783519 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[4-[(2,3-dimethyl-1H-indol-5-yl)methylcarbamoyl]oxolan-2-yl]propanoic acid |
| SMILES | Cc1[nH]c2ccc(CNC(=O)C3COC(CCC(=O)O)C3)cc2c1C |
| InChI | InChI=1S/C19H24N2O4/c1-11-12(2)21-17-5-3-13(7-16(11)17)9-20-19(24)14-8-15(25-10-14)4-6-18(22)23/h3,5,7,14-15,21H,4,6,8-10H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | LKRSHVPVIUEOSD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|