C22H27N3O2 — CID 56744582
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 56744582) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56744582 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(CNC(=O)C3CCCN(Cc4ccco4)C3)cc2c1C |
| InChI | InChI=1S/C22H27N3O2/c1-15-16(2)24-21-8-7-17(11-20(15)21)12-23-22(26)18-5-3-9-25(13-18)14-19-6-4-10-27-19/h4,6-8,10-11,18,24H,3,5,9,12-14H2,1-2H3,(H,23,26) |
| InChIKey | RTINQJWUDLQRCB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|