C16H19ClN2O2S — CID 97210781
(3R)-N-[(5-chlorothiophen-2-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 97210781) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is (3R)-N-[(5-chlorothiophen-2-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[(5-chlorothiophen-2-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97210781 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (3R)-N-[(5-chlorothiophen-2-yl)methyl]-1-(furan-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)s1)[C@@H]1CCCN(Cc2ccco2)C1 |
| InChI | InChI=1S/C16H19ClN2O2S/c17-15-6-5-14(22-15)9-18-16(20)12-3-1-7-19(10-12)11-13-4-2-8-21-13/h2,4-6,8,12H,1,3,7,9-11H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | MDSDRIYQXYQZGW-GFCCVEGCSA-N |
| XLogP | 3.52 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |