C21H24N4O2 — CID 72886430
1-(furan-2-ylmethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 72886430) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72886430 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(furan-2-ylmethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(-n2cccn2)c1)C1CCCN(Cc2ccco2)C1 |
| InChI | InChI=1S/C21H24N4O2/c26-21(18-6-2-10-24(15-18)16-20-8-3-12-27-20)22-14-17-5-1-7-19(13-17)25-11-4-9-23-25/h1,3-5,7-9,11-13,18H,2,6,10,14-16H2,(H,22,26) |
| InChIKey | XMNGIUAPDRCMQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |