C25H26N6O — CID 45195369
N-[4-(1H-pyrazol-5-yl)phenyl]-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 45195369) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[4-(1H-pyrazol-5-yl)phenyl]-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[4-(1H-pyrazol-5-yl)phenyl]-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45195369 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[4-(1H-pyrazol-5-yl)phenyl]-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccn[nH]2)cc1)C1CCCN(Cc2cccc(-n3cccn3)c2)C1 |
| InChI | InChI=1S/C25H26N6O/c32-25(28-22-9-7-20(8-10-22)24-11-13-26-29-24)21-5-2-14-30(18-21)17-19-4-1-6-23(16-19)31-15-3-12-27-31/h1,3-4,6-13,15-16,21H,2,5,14,17-18H2,(H,26,29)(H,28,32) |
| InChIKey | GJDIHJPVGCGJCD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |