C22H23ClN4O — CID 121354922
N-(4-chlorophenyl)-1-[(3-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 121354922) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-[(3-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-[(3-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121354922 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(4-chlorophenyl)-1-[(3-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CCCN(Cc2cccc(-n3ccnc3)c2)C1 |
| InChI | InChI=1S/C22H23ClN4O/c23-19-6-8-20(9-7-19)25-22(28)18-4-2-11-26(15-18)14-17-3-1-5-21(13-17)27-12-10-24-16-27/h1,3,5-10,12-13,16,18H,2,4,11,14-15H2,(H,25,28) |
| InChIKey | UGAVIISVIYYDFS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |